C20H20ClN3O2 — CID 108924939
(E)-3-(4-chlorophenyl)-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]prop-2-enamide (PubChem CID 108924939) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108924939 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H20ClN3O2/c21-17-6-3-15(4-7-17)5-8-19(25)23-18-9-12-24(13-10-18)20(26)16-2-1-11-22-14-16/h1-8,11,14,18H,9-10,12-13H2,(H,23,25)/b8-5+ |
| InChIKey | RSQONVAEDSIDPF-VMPITWQZSA-N |
| XLogP | 3.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|