C18H18ClN3O2 — CID 47797182
N-[1-(2-chlorobenzoyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 47797182) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is N-[1-(2-chlorobenzoyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(2-chlorobenzoyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47797182 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[1-(2-chlorobenzoyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccccc2Cl)CC1)c1cccnc1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-16-6-2-1-5-15(16)18(24)22-10-7-14(8-11-22)21-17(23)13-4-3-9-20-12-13/h1-6,9,12,14H,7-8,10-11H2,(H,21,23) |
| InChIKey | IRNVGGYGLPVEPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |