C18H19N3O3 — CID 110821885
phenyl 4-(pyridine-3-carbonylamino)piperidine-1-carboxylate (PubChem CID 110821885) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is phenyl 4-(pyridine-3-carbonylamino)piperidine-1-carboxylate.
| Compound Name | phenyl 4-(pyridine-3-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110821885 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | phenyl 4-(pyridine-3-carbonylamino)piperidine-1-carboxylate |
| SMILES | O=C(NC1CCN(C(=O)Oc2ccccc2)CC1)c1cccnc1 |
| InChI | InChI=1S/C18H19N3O3/c22-17(14-5-4-10-19-13-14)20-15-8-11-21(12-9-15)18(23)24-16-6-2-1-3-7-16/h1-7,10,13,15H,8-9,11-12H2,(H,20,22) |
| InChIKey | UQDBPGNFZHWRPK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |