C19H20N2O5 — CID 108562900
phenyl 4-[(3,5-dihydroxybenzoyl)amino]piperidine-1-carboxylate (PubChem CID 108562900) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is phenyl 4-[(3,5-dihydroxybenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | phenyl 4-[(3,5-dihydroxybenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108562900 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | phenyl 4-[(3,5-dihydroxybenzoyl)amino]piperidine-1-carboxylate |
| SMILES | O=C(NC1CCN(C(=O)Oc2ccccc2)CC1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C19H20N2O5/c22-15-10-13(11-16(23)12-15)18(24)20-14-6-8-21(9-7-14)19(25)26-17-4-2-1-3-5-17/h1-5,10-12,14,22-23H,6-9H2,(H,20,24) |
| InChIKey | PNCNJIVZYDJKBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |