C19H20N2O5 — CID 108551443
N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-hydroxybenzamide (PubChem CID 108551443) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-hydroxybenzamide.
| Compound Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 108551443 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-hydroxybenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(O)cc(O)c2)CC1)c1ccccc1O |
| InChI | InChI=1S/C19H20N2O5/c22-14-9-12(10-15(23)11-14)19(26)21-7-5-13(6-8-21)20-18(25)16-3-1-2-4-17(16)24/h1-4,9-11,13,22-24H,5-8H2,(H,20,25) |
| InChIKey | OMZYWOZKJRLHLZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |