C19H19FN2O4 — CID 108549393
N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-fluorobenzamide (PubChem CID 108549393) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-fluorobenzamide.
| Compound Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 108549393 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-fluorobenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(O)cc(O)c2)CC1)c1ccccc1F |
| InChI | InChI=1S/C19H19FN2O4/c20-17-4-2-1-3-16(17)18(25)21-13-5-7-22(8-6-13)19(26)12-9-14(23)11-15(24)10-12/h1-4,9-11,13,23-24H,5-8H2,(H,21,25) |
| InChIKey | MBIACMWNYIWGTQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |