C19H18F2N2O4 — CID 108562910
N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide (PubChem CID 108562910) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108562910 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(F)cc2F)CC1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C19H18F2N2O4/c20-12-1-2-16(17(21)9-12)19(27)23-5-3-13(4-6-23)22-18(26)11-7-14(24)10-15(25)8-11/h1-2,7-10,13,24-25H,3-6H2,(H,22,26) |
| InChIKey | YSOCURAIRHQTEF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |