C21H21F2N3O3 — CID 108559772
N-[2-[[1-(2,4-difluorobenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide (PubChem CID 108559772) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is N-[2-[[1-(2,4-difluorobenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[1-(2,4-difluorobenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 108559772 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[2-[[1-(2,4-difluorobenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NC1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C21H21F2N3O3/c22-15-6-7-17(18(23)12-15)21(29)26-10-8-16(9-11-26)25-19(27)13-24-20(28)14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2,(H,24,28)(H,25,27) |
| InChIKey | OBKAEBXOIWEQMI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |