C19H17ClF2N2O2 — CID 108559879
3-chloro-N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]benzamide (PubChem CID 108559879) has the molecular formula C19H17ClF2N2O2 and a molecular weight of 378.81 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 3-chloro-N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108559879 |
| Molecular Formula | C19H17ClF2N2O2 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-chloro-N-[1-(2,4-difluorobenzoyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(F)cc2F)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClF2N2O2/c20-13-3-1-2-12(10-13)18(25)23-15-6-8-24(9-7-15)19(26)16-5-4-14(21)11-17(16)22/h1-5,10-11,15H,6-9H2,(H,23,25) |
| InChIKey | LNBRZZNVDDJUDN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |