C19H18F2N2O5 — CID 108564431
2,4-difluoro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide (PubChem CID 108564431) has the molecular formula C19H18F2N2O5 and a molecular weight of 392.36 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 2,4-difluoro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108564431 |
| Molecular Formula | C19H18F2N2O5 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2,4-difluoro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H18F2N2O5/c20-11-1-2-13(14(21)9-11)18(27)22-12-3-5-23(6-4-12)19(28)10-7-15(24)17(26)16(25)8-10/h1-2,7-9,12,24-26H,3-6H2,(H,22,27) |
| InChIKey | AFLOYJWMYJVBCD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|