C19H19ClN2O5 — CID 108550695
3-chloro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide (PubChem CID 108550695) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is 3-chloro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 3-chloro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108550695 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-chloro-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O5/c20-13-3-1-2-11(8-13)18(26)21-14-4-6-22(7-5-14)19(27)12-9-15(23)17(25)16(24)10-12/h1-3,8-10,14,23-25H,4-7H2,(H,21,26) |
| InChIKey | KBULEGWDVXVIPR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|