C19H18Cl2N2O3 — CID 108567215
2,4-dichloro-N-[1-(3-hydroxybenzoyl)piperidin-4-yl]benzamide (PubChem CID 108567215) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(3-hydroxybenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(3-hydroxybenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108567215 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2,4-dichloro-N-[1-(3-hydroxybenzoyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cccc(O)c2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O3/c20-13-4-5-16(17(21)11-13)18(25)22-14-6-8-23(9-7-14)19(26)12-2-1-3-15(24)10-12/h1-5,10-11,14,24H,6-9H2,(H,22,25) |
| InChIKey | XTZAAOBJZQIBBC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |