C20H20Cl2N2O3 — CID 108559737
N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]-3-methoxybenzamide (PubChem CID 108559737) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]-3-methoxybenzamide.
| Compound Name | N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 108559737 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-27-16-4-2-3-13(11-16)19(25)23-15-7-9-24(10-8-15)20(26)17-6-5-14(21)12-18(17)22/h2-6,11-12,15H,7-10H2,1H3,(H,23,25) |
| InChIKey | AAZPOPUMWQXEEM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |