C18H20N2O4 — CID 38022754
N-[1-(furan-3-carbonyl)piperidin-4-yl]-3-methoxybenzamide (PubChem CID 38022754) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[1-(furan-3-carbonyl)piperidin-4-yl]-3-methoxybenzamide.
| Compound Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 38022754 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2CCN(C(=O)c3ccoc3)CC2)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-23-16-4-2-3-13(11-16)17(21)19-15-5-8-20(9-6-15)18(22)14-7-10-24-12-14/h2-4,7,10-12,15H,5-6,8-9H2,1H3,(H,19,21) |
| InChIKey | FNAQKDRCNLWURQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |