C19H21BrN2O5 — CID 38212968
4-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,5-dimethoxybenzamide (PubChem CID 38212968) has the molecular formula C19H21BrN2O5 and a molecular weight of 437.29 g/mol. Its IUPAC name is 4-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 38212968 |
| Molecular Formula | C19H21BrN2O5 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C(=O)c3ccoc3)CC2)cc(OC)c1Br |
| InChI | InChI=1S/C19H21BrN2O5/c1-25-15-9-13(10-16(26-2)17(15)20)18(23)21-14-3-6-22(7-4-14)19(24)12-5-8-27-11-12/h5,8-11,14H,3-4,6-7H2,1-2H3,(H,21,23) |
| InChIKey | HNVIHEFFKAEZDN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |