C23H30N2O5 — CID 38211238
N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,4-dipropoxybenzamide (PubChem CID 38211238) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,4-dipropoxybenzamide.
| Compound Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,4-dipropoxybenzamide |
|---|---|
| PubChem CID | 38211238 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-3,4-dipropoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC2CCN(C(=O)c3ccoc3)CC2)cc1OCCC |
| InChI | InChI=1S/C23H30N2O5/c1-3-12-29-20-6-5-17(15-21(20)30-13-4-2)22(26)24-19-7-10-25(11-8-19)23(27)18-9-14-28-16-18/h5-6,9,14-16,19H,3-4,7-8,10-13H2,1-2H3,(H,24,26) |
| InChIKey | AGSTVYNWTKFCNQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |