C18H17N3O3 — CID 38209527
3-cyano-N-[1-(furan-3-carbonyl)piperidin-4-yl]benzamide (PubChem CID 38209527) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-cyano-N-[1-(furan-3-carbonyl)piperidin-4-yl]benzamide.
| Compound Name | 3-cyano-N-[1-(furan-3-carbonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 38209527 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-cyano-N-[1-(furan-3-carbonyl)piperidin-4-yl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NC2CCN(C(=O)c3ccoc3)CC2)c1 |
| InChI | InChI=1S/C18H17N3O3/c19-11-13-2-1-3-14(10-13)17(22)20-16-4-7-21(8-5-16)18(23)15-6-9-24-12-15/h1-3,6,9-10,12,16H,4-5,7-8H2,(H,20,22) |
| InChIKey | YZNNOMVEELTSBF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |