About 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide
5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide (PubChem CID 47882723) has the molecular formula C23H30N2O4
and a molecular weight of 398.50 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide.
Molecular Properties
| Compound Name | 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide |
| PubChem CID | 47882723 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)NC2CCN(C(=O)c3ccoc3)CC2)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-17-6-7-18(2)21(15-17)29-13-4-3-5-22(26)24-20-8-11-25(12-9-20)23(27)19-10-14-28-16-19/h6-7,10,14-16,20H,3-5,8-9,11-13H2,1-2H3,(H,24,26) |
| InChIKey | LRXMPOYWKYCIGZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide?
The IUPAC name of 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide (CID 47882723) is 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide.
What is the SMILES notation for 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide?
The canonical SMILES for 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide is Cc1ccc(C)c(OCCCCC(=O)NC2CCN(C(=O)c3ccoc3)CC2)c1.
What is the InChIKey of 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide?
The InChIKey is LRXMPOYWKYCIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O4/c1-17-6-7-18(2)21(15-17)29-13-4-3-5-22(26)24-20-8-11-25(12-9-20)23(27)19-10-14-28-16-19/h6-7,10,14-16,20H,3-5,8-9,11-13H2,1-2H3,(H,24,26).
What are the key properties of 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide?
5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide has a molecular weight of 398.50 g/mol, XLogP of 3.87, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylphenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]pentanamide is sourced from PubChem (CID 47882723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).