C22H27N3O3 — CID 108553773
4-(2-methylphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide (PubChem CID 108553773) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | 4-(2-methylphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108553773 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-(2-methylphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)NC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-17-5-2-3-6-20(17)28-16-4-7-21(26)24-19-10-14-25(15-11-19)22(27)18-8-12-23-13-9-18/h2-3,5-6,8-9,12-13,19H,4,7,10-11,14-16H2,1H3,(H,24,26) |
| InChIKey | GIMODVWSJJPXKZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|