C24H35N3O4 — CID 108553741
4-(2-methylphenoxy)-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide (PubChem CID 108553741) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | 4-(2-methylphenoxy)-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108553741 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 4-(2-methylphenoxy)-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)NC1CCN(C(=O)C2CC(=O)N(C(C)C)C2)CC1 |
| InChI | InChI=1S/C24H35N3O4/c1-17(2)27-16-19(15-23(27)29)24(30)26-12-10-20(11-13-26)25-22(28)9-6-14-31-21-8-5-4-7-18(21)3/h4-5,7-8,17,19-20H,6,9-16H2,1-3H3,(H,25,28) |
| InChIKey | VPIRVEGVMVELCF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|