C23H27ClN2O3 — CID 108553730
N-[1-(2-chlorobenzoyl)piperidin-4-yl]-4-(2-methylphenoxy)butanamide (PubChem CID 108553730) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is N-[1-(2-chlorobenzoyl)piperidin-4-yl]-4-(2-methylphenoxy)butanamide.
| Compound Name | N-[1-(2-chlorobenzoyl)piperidin-4-yl]-4-(2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 108553730 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[1-(2-chlorobenzoyl)piperidin-4-yl]-4-(2-methylphenoxy)butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)NC1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-17-7-2-5-10-21(17)29-16-6-11-22(27)25-18-12-14-26(15-13-18)23(28)19-8-3-4-9-20(19)24/h2-5,7-10,18H,6,11-16H2,1H3,(H,25,27) |
| InChIKey | XLZKBOKRVBOVAC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|