C21H24ClN3O3 — CID 49387753
4-(2-chlorophenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide (PubChem CID 49387753) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 49387753 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]butanamide |
| SMILES | O=C(CCCOc1ccccc1Cl)NC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O3/c22-18-4-1-2-5-19(18)28-15-3-6-20(26)24-17-9-13-25(14-10-17)21(27)16-7-11-23-12-8-16/h1-2,4-5,7-8,11-12,17H,3,6,9-10,13-15H2,(H,24,26) |
| InChIKey | RCRZBFRNEGWUSQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|