C17H25ClN2O4S — CID 49375250
4-(2-chlorophenoxy)-N-(1-ethylsulfonylpiperidin-4-yl)butanamide (PubChem CID 49375250) has the molecular formula C17H25ClN2O4S and a molecular weight of 388.92 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-(1-ethylsulfonylpiperidin-4-yl)butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-(1-ethylsulfonylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 49375250 |
| Molecular Formula | C17H25ClN2O4S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-(1-ethylsulfonylpiperidin-4-yl)butanamide |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN2O4S/c1-2-25(22,23)20-11-9-14(10-12-20)19-17(21)8-5-13-24-16-7-4-3-6-15(16)18/h3-4,6-7,14H,2,5,8-13H2,1H3,(H,19,21) |
| InChIKey | WVYHRGFIVJFIDA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|