C21H31ClN2O3 — CID 49380926
4-(2-chlorophenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]butanamide (PubChem CID 49380926) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 49380926 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]butanamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H31ClN2O3/c1-3-16(4-2)21(26)24-13-11-17(12-14-24)23-20(25)10-7-15-27-19-9-6-5-8-18(19)22/h5-6,8-9,16-17H,3-4,7,10-15H2,1-2H3,(H,23,25) |
| InChIKey | OKFFEYZWJQIGAH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|