C23H26Cl2N2O3 — CID 108561216
4-(2-chlorophenoxy)-N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]butanamide (PubChem CID 108561216) has the molecular formula C23H26Cl2N2O3 and a molecular weight of 449.38 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108561216 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]butanamide |
| SMILES | O=C(CCCOc1ccccc1Cl)NC1CCN(C(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H26Cl2N2O3/c24-18-9-7-17(8-10-18)16-23(29)27-13-11-19(12-14-27)26-22(28)6-3-15-30-21-5-2-1-4-20(21)25/h1-2,4-5,7-10,19H,3,6,11-16H2,(H,26,28) |
| InChIKey | MTLMMNOWHCKUJW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|