C24H27ClN2O3 — CID 108561213
4-(2-chlorophenoxy)-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]butanamide (PubChem CID 108561213) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108561213 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]butanamide |
| SMILES | O=C(CCCOc1ccccc1Cl)NC1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27ClN2O3/c25-21-9-4-5-10-22(21)30-18-6-11-23(28)26-20-14-16-27(17-15-20)24(29)13-12-19-7-2-1-3-8-19/h1-5,7-10,12-13,20H,6,11,14-18H2,(H,26,28)/b13-12+ |
| InChIKey | GEIRCPNXFPUKOD-OUKQBFOZSA-N |
| XLogP | 4.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|