C23H27ClN2O4 — CID 108561231
benzyl 4-[4-(2-chlorophenoxy)butanoylamino]piperidine-1-carboxylate (PubChem CID 108561231) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is benzyl 4-[4-(2-chlorophenoxy)butanoylamino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[4-(2-chlorophenoxy)butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108561231 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | benzyl 4-[4-(2-chlorophenoxy)butanoylamino]piperidine-1-carboxylate |
| SMILES | O=C(CCCOc1ccccc1Cl)NC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27ClN2O4/c24-20-9-4-5-10-21(20)29-16-6-11-22(27)25-19-12-14-26(15-13-19)23(28)30-17-18-7-2-1-3-8-18/h1-5,7-10,19H,6,11-17H2,(H,25,27) |
| InChIKey | FUVYRGBKZYLMND-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|