C26H34N2O4 — CID 108553731
N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-4-(2-methylphenoxy)butanamide (PubChem CID 108553731) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-4-(2-methylphenoxy)butanamide.
| Compound Name | N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-4-(2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 108553731 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-4-(2-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCC(=O)N2CCC(NC(=O)CCCOc3ccccc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C26H34N2O4/c1-19-10-11-24(21(3)17-19)32-18-26(30)28-14-12-22(13-15-28)27-25(29)9-6-16-31-23-8-5-4-7-20(23)2/h4-5,7-8,10-11,17,22H,6,9,12-16,18H2,1-3H3,(H,27,29) |
| InChIKey | ASPXINSWAQJYNL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|