C24H30N2O5 — CID 108549766
N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-2,6-dimethoxybenzamide (PubChem CID 108549766) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 108549766 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[1-[2-(2,4-dimethylphenoxy)acetyl]piperidin-4-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC1CCN(C(=O)COc2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C24H30N2O5/c1-16-8-9-19(17(2)14-16)31-15-22(27)26-12-10-18(11-13-26)25-24(28)23-20(29-3)6-5-7-21(23)30-4/h5-9,14,18H,10-13,15H2,1-4H3,(H,25,28) |
| InChIKey | AOXLLUNIXYZLKN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |