C22H30ClN3O3 — CID 108564809
4-chloro-N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]butanamide (PubChem CID 108564809) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is 4-chloro-N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]butanamide.
| Compound Name | 4-chloro-N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108564809 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-chloro-N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]butanamide |
| SMILES | CC(c1ccccc1)N1CC(C(=O)N2CCC(NC(=O)CCCCl)CC2)CC1=O |
| InChI | InChI=1S/C22H30ClN3O3/c1-16(17-6-3-2-4-7-17)26-15-18(14-21(26)28)22(29)25-12-9-19(10-13-25)24-20(27)8-5-11-23/h2-4,6-7,16,18-19H,5,8-15H2,1H3,(H,24,27) |
| InChIKey | WKGAVONAWLLOAL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|