C21H28ClN3O4 — CID 108564820
2-chloroethyl N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]carbamate (PubChem CID 108564820) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-chloroethyl N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]carbamate.
| Compound Name | 2-chloroethyl N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564820 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-chloroethyl N-[1-[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]piperidin-4-yl]carbamate |
| SMILES | CC(c1ccccc1)N1CC(C(=O)N2CCC(NC(=O)OCCCl)CC2)CC1=O |
| InChI | InChI=1S/C21H28ClN3O4/c1-15(16-5-3-2-4-6-16)25-14-17(13-19(25)26)20(27)24-10-7-18(8-11-24)23-21(28)29-12-9-22/h2-6,15,17-18H,7-14H2,1H3,(H,23,28) |
| InChIKey | PEWNBLOBXGLADL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|