C17H28ClN3O3 — CID 108564916
4-chloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide (PubChem CID 108564916) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is 4-chloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | 4-chloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108564916 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-chloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]butanamide |
| SMILES | CC(C)N1CC(C(=O)N2CCC(NC(=O)CCCCl)CC2)CC1=O |
| InChI | InChI=1S/C17H28ClN3O3/c1-12(2)21-11-13(10-16(21)23)17(24)20-8-5-14(6-9-20)19-15(22)4-3-7-18/h12-14H,3-11H2,1-2H3,(H,19,22) |
| InChIKey | UVHWEAGYGXCYIZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|