C15H23Cl2N3O3 — CID 108564919
2,2-dichloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]acetamide (PubChem CID 108564919) has the molecular formula C15H23Cl2N3O3 and a molecular weight of 364.27 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108564919 |
| Molecular Formula | C15H23Cl2N3O3 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2,2-dichloro-N-[1-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CC(C)N1CC(C(=O)N2CCC(NC(=O)C(Cl)Cl)CC2)CC1=O |
| InChI | InChI=1S/C15H23Cl2N3O3/c1-9(2)20-8-10(7-12(20)21)15(23)19-5-3-11(4-6-19)18-14(22)13(16)17/h9-11,13H,3-8H2,1-2H3,(H,18,22) |
| InChIKey | SQXILJXHBUEMCJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|