C25H37N3O4 — CID 108553431
N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide (PubChem CID 108553431) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 108553431 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)NC2CCN(C(=O)C3CC(=O)N(C(C)(C)C)C3)CC2)cc1 |
| InChI | InChI=1S/C25H37N3O4/c1-18-7-9-21(10-8-18)32-15-5-6-22(29)26-20-11-13-27(14-12-20)24(31)19-16-23(30)28(17-19)25(2,3)4/h7-10,19-20H,5-6,11-17H2,1-4H3,(H,26,29) |
| InChIKey | WREJTYWYLITQPF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|