C25H37N3O4 — CID 108546241
1-tert-butyl-4-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepane-1-carbonyl]pyrrolidin-2-one (PubChem CID 108546241) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepane-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-tert-butyl-4-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 108546241 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1-tert-butyl-4-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CCCN(C(=O)C3CC(=O)N(C(C)(C)C)C3)CC2)cc1 |
| InChI | InChI=1S/C25H37N3O4/c1-19-8-10-21(11-9-19)32-16-5-7-22(29)26-12-6-13-27(15-14-26)24(31)20-17-23(30)28(18-20)25(2,3)4/h8-11,20H,5-7,12-18H2,1-4H3 |
| InChIKey | HOPULCKLNBEZSZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|