C21H32N2O3 — CID 108544354
3-methyl-1-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108544354) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 3-methyl-1-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108544354 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 3-methyl-1-[4-[4-(4-methylphenoxy)butanoyl]-1,4-diazepan-1-yl]butan-1-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CCCN(C(=O)CC(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O3/c1-17(2)16-21(25)23-12-5-11-22(13-14-23)20(24)6-4-15-26-19-9-7-18(3)8-10-19/h7-10,17H,4-6,11-16H2,1-3H3 |
| InChIKey | ZZGQXUNVLOPLHE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|