C20H30N2O4 — CID 108569006
2-methylpropyl 4-[4-(4-methylphenoxy)butanoyl]piperazine-1-carboxylate (PubChem CID 108569006) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-methylpropyl 4-[4-(4-methylphenoxy)butanoyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[4-(4-methylphenoxy)butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108569006 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-methylpropyl 4-[4-(4-methylphenoxy)butanoyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(OCCCC(=O)N2CCN(C(=O)OCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-16(2)15-26-20(24)22-12-10-21(11-13-22)19(23)5-4-14-25-18-8-6-17(3)7-9-18/h6-9,16H,4-5,10-15H2,1-3H3 |
| InChIKey | ULGCBRPRPQOAMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|