C20H29ClN2O4 — CID 60619102
2-methylpropyl 4-[4-(2-chlorophenoxy)butanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 60619102) has the molecular formula C20H29ClN2O4 and a molecular weight of 396.92 g/mol. Its IUPAC name is 2-methylpropyl 4-[4-(2-chlorophenoxy)butanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[4-(2-chlorophenoxy)butanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 60619102 |
| Molecular Formula | C20H29ClN2O4 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-methylpropyl 4-[4-(2-chlorophenoxy)butanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCCN(C(=O)CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H29ClN2O4/c1-16(2)15-27-20(25)23-11-6-10-22(12-13-23)19(24)9-5-14-26-18-8-4-3-7-17(18)21/h3-4,7-8,16H,5-6,9-15H2,1-2H3 |
| InChIKey | HOPGRGBJLOJILA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|