C20H29ClN2O5 — CID 108547056
4-(2-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108547056) has the molecular formula C20H29ClN2O5 and a molecular weight of 412.91 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(2-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108547056 |
| Molecular Formula | C20H29ClN2O5 |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-(2-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]butan-1-one |
| SMILES | COCCOCC(=O)N1CCCN(C(=O)CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H29ClN2O5/c1-26-14-15-27-16-20(25)23-10-5-9-22(11-12-23)19(24)8-4-13-28-18-7-3-2-6-17(18)21/h2-3,6-7H,4-5,8-16H2,1H3 |
| InChIKey | OSBVHVWVCSUBNC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|