C17H22ClFN2O4 — CID 108548062
1-[4-(2-chloro-6-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methoxyethoxy)ethanone (PubChem CID 108548062) has the molecular formula C17H22ClFN2O4 and a molecular weight of 372.82 g/mol. Its IUPAC name is 1-[4-(2-chloro-6-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-[4-(2-chloro-6-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 108548062 |
| Molecular Formula | C17H22ClFN2O4 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[4-(2-chloro-6-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CCCN(C(=O)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H22ClFN2O4/c1-24-10-11-25-12-15(22)20-6-3-7-21(9-8-20)17(23)16-13(18)4-2-5-14(16)19/h2,4-5H,3,6-12H2,1H3 |
| InChIKey | WOKFEXNEUWIEFV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|