C17H24N2O4 — CID 108547755
1-(4-benzoyl-1,4-diazepan-1-yl)-2-(2-methoxyethoxy)ethanone (PubChem CID 108547755) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 108547755 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N2O4/c1-22-12-13-23-14-16(20)18-8-5-9-19(11-10-18)17(21)15-6-3-2-4-7-15/h2-4,6-7H,5,8-14H2,1H3 |
| InChIKey | KVMYTEDBSKTZKM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|