C14H18N2O2 — CID 44603157
1-(4-benzoyl-1,4-diazepan-1-yl)ethanone (PubChem CID 44603157) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(4-benzoyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 1-(4-benzoyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 44603157 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(4-benzoyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H18N2O2/c1-12(17)15-8-5-9-16(11-10-15)14(18)13-6-3-2-4-7-13/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | QMHHUJIWBXISIB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |