C14H19N3O2 — CID 1121209
4-benzoyl-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 1121209) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-benzoyl-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-benzoyl-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 1121209 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-benzoyl-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H19N3O2/c1-15(2)14(19)17-10-8-16(9-11-17)13(18)12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | BSCLQXYPSGXJTQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |