C16H24N4O2 — CID 110397809
3-[2-(4-benzoylpiperazin-1-yl)ethyl]-1,1-dimethylurea (PubChem CID 110397809) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[2-(4-benzoylpiperazin-1-yl)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4-benzoylpiperazin-1-yl)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 110397809 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-[2-(4-benzoylpiperazin-1-yl)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCN1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-18(2)16(22)17-8-9-19-10-12-20(13-11-19)15(21)14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3,(H,17,22) |
| InChIKey | JTAMWXVZQZUSKB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |