C18H26N2O5 — CID 108547727
2-(2-methoxyethoxy)-1-[4-(2-phenoxyacetyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 108547727) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-1-[4-(2-phenoxyacetyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(2-methoxyethoxy)-1-[4-(2-phenoxyacetyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108547727 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(2-methoxyethoxy)-1-[4-(2-phenoxyacetyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COCCOCC(=O)N1CCCN(C(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O5/c1-23-12-13-24-14-17(21)19-8-5-9-20(11-10-19)18(22)15-25-16-6-3-2-4-7-16/h2-4,6-7H,5,8-15H2,1H3 |
| InChIKey | HVCLZZUYRURSHY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|