C16H22N2O3 — CID 108547620
2-methoxy-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 108547620) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-methoxy-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108547620 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-methoxy-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COCC(=O)N1CCCN(C(=O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C16H22N2O3/c1-13-5-3-6-14(11-13)16(20)18-8-4-7-17(9-10-18)15(19)12-21-2/h3,5-6,11H,4,7-10,12H2,1-2H3 |
| InChIKey | LESGFJFTLMWAHD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |