C23H28N2O4 — CID 36629430
2-(4-ethoxyphenoxy)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 36629430) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(4-ethoxyphenoxy)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 36629430 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCOc1ccc(OCC(=O)N2CCCN(C(=O)c3cccc(C)c3)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-3-28-20-8-10-21(11-9-20)29-17-22(26)24-12-5-13-25(15-14-24)23(27)19-7-4-6-18(2)16-19/h4,6-11,16H,3,5,12-15,17H2,1-2H3 |
| InChIKey | ARUCDEHVEKZGQX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |