C22H26N2O3 — CID 38462830
2-(3-methoxyphenyl)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 38462830) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(3-methoxyphenyl)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 38462830 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COc1cccc(CC(=O)N2CCCN(C(=O)c3cccc(C)c3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-17-6-3-8-19(14-17)22(26)24-11-5-10-23(12-13-24)21(25)16-18-7-4-9-20(15-18)27-2/h3-4,6-9,14-15H,5,10-13,16H2,1-2H3 |
| InChIKey | SZUIVTAZUAXBFX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |