C16H22ClFN2O3 — CID 137345496
(2-chloro-6-fluorophenyl)-[4-[2-(2-hydroxyethoxy)ethyl]-1,4-diazepan-1-yl]methanone (PubChem CID 137345496) has the molecular formula C16H22ClFN2O3 and a molecular weight of 344.81 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[4-[2-(2-hydroxyethoxy)ethyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[4-[2-(2-hydroxyethoxy)ethyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 137345496 |
| Molecular Formula | C16H22ClFN2O3 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[4-[2-(2-hydroxyethoxy)ethyl]-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1Cl)N1CCCN(CCOCCO)CC1 |
| InChI | InChI=1S/C16H22ClFN2O3/c17-13-3-1-4-14(18)15(13)16(22)20-6-2-5-19(7-8-20)9-11-23-12-10-21/h1,3-4,21H,2,5-12H2 |
| InChIKey | ZAGSQSVGBROKBJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|