C24H29ClN2O3 — CID 108547054
4-(2-chlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108547054) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(2-chlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108547054 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 4-(2-chlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | Cc1ccc(C(=O)N2CCCN(C(=O)CCCOc3ccccc3Cl)CC2)cc1C |
| InChI | InChI=1S/C24H29ClN2O3/c1-18-10-11-20(17-19(18)2)24(29)27-13-6-12-26(14-15-27)23(28)9-5-16-30-22-8-4-3-7-21(22)25/h3-4,7-8,10-11,17H,5-6,9,12-16H2,1-2H3 |
| InChIKey | ZYPURPZFXFQVRJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|